C22H33NO3 — CID 11013808
methyl (1R,3R,5S,7R)-3-nonyl-7-phenyl-6-oxa-2-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 11013808) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is methyl (1R,3R,5S,7R)-3-nonyl-7-phenyl-6-oxa-2-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methyl (1R,3R,5S,7R)-3-nonyl-7-phenyl-6-oxa-2-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11013808 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | methyl (1R,3R,5S,7R)-3-nonyl-7-phenyl-6-oxa-2-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCCCCCC[C@@H]1C[C@@H]2O[C@H](c3ccccc3)[C@@H]2N1C(=O)OC |
| InChI | InChI=1S/C22H33NO3/c1-3-4-5-6-7-8-12-15-18-16-19-20(23(18)22(24)25-2)21(26-19)17-13-10-9-11-14-17/h9-11,13-14,18-21H,3-8,12,15-16H2,1-2H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | FXJGJDXUANYOEK-PLACYPQZSA-N |
| XLogP | 5.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|