C19H29NO — CID 98220206
cis-(1R,2R)-N-benzyl-2-octylcyclopropane-1-carboxamide (PubChem CID 98220206) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is cis-(1R,2R)-N-benzyl-2-octylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-benzyl-2-octylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 98220206 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | cis-(1R,2R)-N-benzyl-2-octylcyclopropane-1-carboxamide |
| SMILES | CCCCCCCC[C@@H]1C[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H29NO/c1-2-3-4-5-6-10-13-17-14-18(17)19(21)20-15-16-11-8-7-9-12-16/h7-9,11-12,17-18H,2-6,10,13-15H2,1H3,(H,20,21)/t17-,18-/m1/s1 |
| InChIKey | IACGVITVTNVFPO-QZTJIDSGSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|