C22H35NO — CID 123659272
4-(2-heptylcyclopropyl)-N-(2-phenylethyl)butanamide (PubChem CID 123659272) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is 4-(2-heptylcyclopropyl)-N-(2-phenylethyl)butanamide.
| Compound Name | 4-(2-heptylcyclopropyl)-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 123659272 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 4-(2-heptylcyclopropyl)-N-(2-phenylethyl)butanamide |
| SMILES | CCCCCCCC1CC1CCCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H35NO/c1-2-3-4-5-9-13-20-18-21(20)14-10-15-22(24)23-17-16-19-11-7-6-8-12-19/h6-8,11-12,20-21H,2-5,9-10,13-18H2,1H3,(H,23,24) |
| InChIKey | BIVCNYSBAFSDCG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|