C27H44N2O2 — CID 98044630
N-octyl-4-[[(1R,2R)-2-octylcyclopropanecarbonyl]amino]benzamide (PubChem CID 98044630) has the molecular formula C27H44N2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is N-octyl-4-[[(1R,2R)-2-octylcyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-octyl-4-[[(1R,2R)-2-octylcyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 98044630 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | N-octyl-4-[[(1R,2R)-2-octylcyclopropanecarbonyl]amino]benzamide |
| SMILES | CCCCCCCCNC(=O)c1ccc(NC(=O)[C@@H]2C[C@H]2CCCCCCCC)cc1 |
| InChI | InChI=1S/C27H44N2O2/c1-3-5-7-9-11-13-15-23-21-25(23)27(31)29-24-18-16-22(17-19-24)26(30)28-20-14-12-10-8-6-4-2/h16-19,23,25H,3-15,20-21H2,1-2H3,(H,28,30)(H,29,31)/t23-,25-/m1/s1 |
| InChIKey | NWIFRDQEAOJOGK-ILBGXUMGSA-N |
| XLogP | 7.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|