C20H31NO — CID 98156017
trans-(1S,2R)-N-(3-ethylphenyl)-2-octylcyclopropane-1-carboxamide (PubChem CID 98156017) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is trans-(1S,2R)-N-(3-ethylphenyl)-2-octylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2R)-N-(3-ethylphenyl)-2-octylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 98156017 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | trans-(1S,2R)-N-(3-ethylphenyl)-2-octylcyclopropane-1-carboxamide |
| SMILES | CCCCCCCC[C@@H]1C[C@@H]1C(=O)Nc1cccc(CC)c1 |
| InChI | InChI=1S/C20H31NO/c1-3-5-6-7-8-9-12-17-15-19(17)20(22)21-18-13-10-11-16(4-2)14-18/h10-11,13-14,17,19H,3-9,12,15H2,1-2H3,(H,21,22)/t17-,19+/m1/s1 |
| InChIKey | CCZINWJAVMHNRR-MJGOQNOKSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|