C24H27NO4 — CID 122203042
diethyl 6,7,9,14a-tetrahydro-5H-isoquinolino[3,2-a][2]benzazepine-14,14-dicarboxylate (PubChem CID 122203042) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is diethyl 6,7,9,14a-tetrahydro-5H-isoquinolino[3,2-a][2]benzazepine-14,14-dicarboxylate.
| Compound Name | diethyl 6,7,9,14a-tetrahydro-5H-isoquinolino[3,2-a][2]benzazepine-14,14-dicarboxylate |
|---|---|
| PubChem CID | 122203042 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | diethyl 6,7,9,14a-tetrahydro-5H-isoquinolino[3,2-a][2]benzazepine-14,14-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2CN2CCCc3ccccc3C21 |
| InChI | InChI=1S/C24H27NO4/c1-3-28-22(26)24(23(27)29-4-2)20-14-8-6-11-18(20)16-25-15-9-12-17-10-5-7-13-19(17)21(24)25/h5-8,10-11,13-14,21H,3-4,9,12,15-16H2,1-2H3 |
| InChIKey | ZKOJTKAVJSIGHC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|