C19H25NO4 — CID 135020732
dimethyl (1S,9R)-12-tert-butyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate (PubChem CID 135020732) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is dimethyl (1S,9R)-12-tert-butyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate.
| Compound Name | dimethyl (1S,9R)-12-tert-butyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate |
|---|---|
| PubChem CID | 135020732 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | dimethyl (1S,9R)-12-tert-butyl-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2Cc3ccccc3[C@@H]1N2C(C)(C)C |
| InChI | InChI=1S/C19H25NO4/c1-18(2,3)20-13-10-12-8-6-7-9-14(12)15(20)19(11-13,16(21)23-4)17(22)24-5/h6-9,13,15H,10-11H2,1-5H3/t13-,15+/m1/s1 |
| InChIKey | IFHKBCUJIBPCDR-HIFRSBDPSA-N |
| XLogP | 2.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|