C21H25NO2 — CID 102580157
tert-butyl 2-benzyl-3,4-dihydro-1H-isoquinoline-4-carboxylate (PubChem CID 102580157) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl 2-benzyl-3,4-dihydro-1H-isoquinoline-4-carboxylate.
| Compound Name | tert-butyl 2-benzyl-3,4-dihydro-1H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 102580157 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | tert-butyl 2-benzyl-3,4-dihydro-1H-isoquinoline-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CN(Cc2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C21H25NO2/c1-21(2,3)24-20(23)19-15-22(13-16-9-5-4-6-10-16)14-17-11-7-8-12-18(17)19/h4-12,19H,13-15H2,1-3H3 |
| InChIKey | FHJWDMNWUSNSTB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |