C18H22N2 — CID 129403964
(4S)-2-benzyl-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-4-amine (PubChem CID 129403964) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (4S)-2-benzyl-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-4-amine.
| Compound Name | (4S)-2-benzyl-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-4-amine |
|---|---|
| PubChem CID | 129403964 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (4S)-2-benzyl-N,N-dimethyl-3,4-dihydro-1H-isoquinolin-4-amine |
| SMILES | CN(C)[C@@H]1CN(Cc2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C18H22N2/c1-19(2)18-14-20(12-15-8-4-3-5-9-15)13-16-10-6-7-11-17(16)18/h3-11,18H,12-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | PMJCJXLTKZJWSN-GOSISDBHSA-N |
| XLogP | 3.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |