About (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline
(4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline (PubChem CID 7202580) has the molecular formula C16H16FN
and a molecular weight of 241.31 g/mol. Its IUPAC name is (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 7202580 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline |
| SMILES | F[C@@H]1CN(Cc2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C16H16FN/c17-16-12-18(10-13-6-2-1-3-7-13)11-14-8-4-5-9-15(14)16/h1-9,16H,10-12H2/t16-/m1/s1 |
| InChIKey | VWVIVWYOXWQYAM-MRXNPFEDSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline?
The IUPAC name of (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline (CID 7202580) is (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline is F[C@@H]1CN(Cc2ccccc2)Cc2ccccc21.
What is the InChIKey of (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline?
The InChIKey is VWVIVWYOXWQYAM-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H16FN/c17-16-12-18(10-13-6-2-1-3-7-13)11-14-8-4-5-9-15(14)16/h1-9,16H,10-12H2/t16-/m1/s1.
What are the key properties of (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline?
(4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline has a molecular weight of 241.31 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-benzyl-4-fluoro-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 7202580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).