C20H19NS — CID 12737000
6-benzyl-4-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 12737000) has the molecular formula C20H19NS and a molecular weight of 305.45 g/mol. Its IUPAC name is 6-benzyl-4-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine.
| Compound Name | 6-benzyl-4-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 12737000 |
| Molecular Formula | C20H19NS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 6-benzyl-4-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
| SMILES | c1ccc(CN2Cc3sccc3C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H19NS/c1-3-7-16(8-4-1)13-21-14-19(17-9-5-2-6-10-17)18-11-12-22-20(18)15-21/h1-12,19H,13-15H2 |
| InChIKey | OBRLSFUVNJCEGQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |