C23H25NO4 — CID 162398916
diethyl 5,6,8,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13,13-dicarboxylate (PubChem CID 162398916) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is diethyl 5,6,8,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13,13-dicarboxylate.
| Compound Name | diethyl 5,6,8,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13,13-dicarboxylate |
|---|---|
| PubChem CID | 162398916 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | diethyl 5,6,8,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13,13-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2CN2CCc3ccccc3C21 |
| InChI | InChI=1S/C23H25NO4/c1-3-27-21(25)23(22(26)28-4-2)19-12-8-6-10-17(19)15-24-14-13-16-9-5-7-11-18(16)20(23)24/h5-12,20H,3-4,13-15H2,1-2H3 |
| InChIKey | RCAFPANWMWDRAZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|