C21H21NO4 — CID 25191675
dimethyl 6,7,11b,13-tetrahydroisoquinolino[2,1-a]quinoline-12,12-dicarboxylate (PubChem CID 25191675) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is dimethyl 6,7,11b,13-tetrahydroisoquinolino[2,1-a]quinoline-12,12-dicarboxylate.
| Compound Name | dimethyl 6,7,11b,13-tetrahydroisoquinolino[2,1-a]quinoline-12,12-dicarboxylate |
|---|---|
| PubChem CID | 25191675 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | dimethyl 6,7,11b,13-tetrahydroisoquinolino[2,1-a]quinoline-12,12-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2N2CCc3ccccc3C21 |
| InChI | InChI=1S/C21H21NO4/c1-25-19(23)21(20(24)26-2)13-15-8-4-6-10-17(15)22-12-11-14-7-3-5-9-16(14)18(21)22/h3-10,18H,11-13H2,1-2H3 |
| InChIKey | YZZYJQGDTVHMGH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|