C17H21NO4 — CID 102279184
dimethyl 1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5-dicarboxylate (PubChem CID 102279184) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is dimethyl 1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5-dicarboxylate.
| Compound Name | dimethyl 1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5-dicarboxylate |
|---|---|
| PubChem CID | 102279184 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | dimethyl 1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2N2CCCCC21 |
| InChI | InChI=1S/C17H21NO4/c1-21-15(19)17(16(20)22-2)11-12-7-3-4-8-13(12)18-10-6-5-9-14(17)18/h3-4,7-8,14H,5-6,9-11H2,1-2H3 |
| InChIKey | MSEFPGQZWVLHCF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|