C16H19NO4 — CID 4980051
dimethyl 2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,4-dicarboxylate (PubChem CID 4980051) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is dimethyl 2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,4-dicarboxylate.
| Compound Name | dimethyl 2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,4-dicarboxylate |
|---|---|
| PubChem CID | 4980051 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | dimethyl 2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2N2CCCC21 |
| InChI | InChI=1S/C16H19NO4/c1-20-14(18)16(15(19)21-2)10-11-6-3-4-7-12(11)17-9-5-8-13(16)17/h3-4,6-7,13H,5,8-10H2,1-2H3 |
| InChIKey | MKIRGABASPETSK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|