C18H23NO4 — CID 162399831
diethyl 3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate (PubChem CID 162399831) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is diethyl 3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate.
| Compound Name | diethyl 3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162399831 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | diethyl 3,5,6,10b-tetrahydro-2H-pyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCN2CCc3ccccc3C21 |
| InChI | InChI=1S/C18H23NO4/c1-3-22-16(20)18(17(21)23-4-2)10-12-19-11-9-13-7-5-6-8-14(13)15(18)19/h5-8,15H,3-4,9-12H2,1-2H3 |
| InChIKey | LPJXNVSQGQUALN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|