C23H26NO3S+ — CID 11488376
(1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one (PubChem CID 11488376) has the molecular formula C23H26NO3S+ and a molecular weight of 396.53 g/mol. Its IUPAC name is (1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one.
| Compound Name | (1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one |
|---|---|
| PubChem CID | 11488376 |
| Molecular Formula | C23H26NO3S+ |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one |
| SMILES | O=C1OCC[C@H](Sc2ccccc2)[C@H]2O[N+]3(Cc4ccccc4)CCC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C23H26NO3S/c25-23-21-19-12-7-14-24(19,16-17-8-3-1-4-9-17)27-22(21)20(13-15-26-23)28-18-10-5-2-6-11-18/h1-6,8-11,19-22H,7,12-16H2/q+1/t19-,20+,21-,22-,24?/m1/s1 |
| InChIKey | CQGBBXRRJSPZLB-POQMNXHYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|