C19H24NO4S+ — CID 11775078
S-[(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] ethanethioate (PubChem CID 11775078) has the molecular formula C19H24NO4S+ and a molecular weight of 362.47 g/mol. Its IUPAC name is S-[(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] ethanethioate.
| Compound Name | S-[(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] ethanethioate |
|---|---|
| PubChem CID | 11775078 |
| Molecular Formula | C19H24NO4S+ |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | S-[(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1CCOC(=O)[C@H]2[C@@H]1O[N+]1(Cc3ccccc3)CCC[C@H]21 |
| InChI | InChI=1S/C19H24NO4S/c1-13(21)25-16-9-11-23-19(22)17-15-8-5-10-20(15,24-18(16)17)12-14-6-3-2-4-7-14/h2-4,6-7,15-18H,5,8-12H2,1H3/q+1/t15-,16+,17-,18-,20?/m1/s1 |
| InChIKey | RLHJUOWHLHVFEC-CYFCUZRWSA-N |
| XLogP | 2.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|