C19H24BrNO5 — CID 11418883
[(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate bromide (PubChem CID 11418883) has the molecular formula C19H24BrNO5 and a molecular weight of 426.31 g/mol. Its IUPAC name is [(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate bromide.
| Compound Name | [(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate bromide |
|---|---|
| PubChem CID | 11418883 |
| Molecular Formula | C19H24BrNO5 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | [(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate bromide |
| SMILES | CC(=O)O[C@H]1CCOC(=O)[C@H]2[C@@H]1O[N+]1(Cc3ccccc3)CCC[C@H]21.[Br-] |
| InChI | InChI=1S/C19H24NO5.BrH/c1-13(21)24-16-9-11-23-19(22)17-15-8-5-10-20(15,25-18(16)17)12-14-6-3-2-4-7-14;/h2-4,6-7,15-18H,5,8-12H2,1H3;1H/q+1;/p-1/t15-,16+,17-,18-,20?;/m1./s1 |
| InChIKey | ONMYIBWSYQIDQF-REYNMZFRSA-M |
| XLogP | -1.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|