C19H25NO4 — CID 10426831
(1S,12S,13S,16R)-13-butyl-13-ethoxy-11,14-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-trien-15-one (PubChem CID 10426831) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (1S,12S,13S,16R)-13-butyl-13-ethoxy-11,14-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-trien-15-one.
| Compound Name | (1S,12S,13S,16R)-13-butyl-13-ethoxy-11,14-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-trien-15-one |
|---|---|
| PubChem CID | 10426831 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (1S,12S,13S,16R)-13-butyl-13-ethoxy-11,14-dioxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6-trien-15-one |
| SMILES | CCCC[C@]1(OCC)OC(=O)[C@@H]2[C@H]3c4ccccc4CCN3O[C@@H]21 |
| InChI | InChI=1S/C19H25NO4/c1-3-5-11-19(22-4-2)17-15(18(21)23-19)16-14-9-7-6-8-13(14)10-12-20(16)24-17/h6-9,15-17H,3-5,10-12H2,1-2H3/t15-,16-,17+,19+/m1/s1 |
| InChIKey | OUVJFCKAODAODQ-VXNCWWDNSA-N |
| XLogP | 3.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |