C19H24NO5+ — CID 11418884
[(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate (PubChem CID 11418884) has the molecular formula C19H24NO5+ and a molecular weight of 346.40 g/mol. Its IUPAC name is [(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate.
| Compound Name | [(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate |
|---|---|
| PubChem CID | 11418884 |
| Molecular Formula | C19H24NO5+ |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [(1R,2R,8S,9S)-6-benzyl-13-oxo-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCOC(=O)[C@H]2[C@@H]1O[N+]1(Cc3ccccc3)CCC[C@H]21 |
| InChI | InChI=1S/C19H24NO5/c1-13(21)24-16-9-11-23-19(22)17-15-8-5-10-20(15,25-18(16)17)12-14-6-3-2-4-7-14/h2-4,6-7,15-18H,5,8-12H2,1H3/q+1/t15-,16+,17-,18-,20?/m1/s1 |
| InChIKey | NWEWUBMDFXTFDL-CYFCUZRWSA-N |
| XLogP | 1.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|