C17H22NO3+ — CID 11291585
(1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one (PubChem CID 11291585) has the molecular formula C17H22NO3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is (1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one.
| Compound Name | (1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one |
|---|---|
| PubChem CID | 11291585 |
| Molecular Formula | C17H22NO3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one |
| SMILES | O=C1OCCC[C@H]2O[N+]3(Cc4ccccc4)CCC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C17H22NO3/c19-17-16-14-8-4-10-18(14,12-13-6-2-1-3-7-13)21-15(16)9-5-11-20-17/h1-3,6-7,14-16H,4-5,8-12H2/q+1/t14-,15-,16-,18?/m1/s1 |
| InChIKey | WIJYTWVIBUNVLT-FLZRJIMASA-N |
| XLogP | 2.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|