C17H22BrNO3 — CID 11291584
(1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide (PubChem CID 11291584) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is (1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide.
| Compound Name | (1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide |
|---|---|
| PubChem CID | 11291584 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (1R,2R,8R)-6-benzyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide |
| SMILES | O=C1OCCC[C@H]2O[N+]3(Cc4ccccc4)CCC[C@@H]3[C@@H]12.[Br-] |
| InChI | InChI=1S/C17H22NO3.BrH/c19-17-16-14-8-4-10-18(14,12-13-6-2-1-3-7-13)21-15(16)9-5-11-20-17;/h1-3,6-7,14-16H,4-5,8-12H2;1H/q+1;/p-1/t14-,15-,16-,18?;/m1./s1 |
| InChIKey | JIEZCJDXPWMWHI-ICDCTDCASA-M |
| XLogP | -0.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|