C19H25NO4 — CID 11416278
[(4R,6S)-6-[(2R)-1-benzylpyrrolidin-2-yl]-7-oxooxepan-4-yl] acetate (PubChem CID 11416278) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is [(4R,6S)-6-[(2R)-1-benzylpyrrolidin-2-yl]-7-oxooxepan-4-yl] acetate.
| Compound Name | [(4R,6S)-6-[(2R)-1-benzylpyrrolidin-2-yl]-7-oxooxepan-4-yl] acetate |
|---|---|
| PubChem CID | 11416278 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [(4R,6S)-6-[(2R)-1-benzylpyrrolidin-2-yl]-7-oxooxepan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCOC(=O)[C@H]([C@H]2CCCN2Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H25NO4/c1-14(21)24-16-9-11-23-19(22)17(12-16)18-8-5-10-20(18)13-15-6-3-2-4-7-15/h2-4,6-7,16-18H,5,8-13H2,1H3/t16-,17-,18+/m0/s1 |
| InChIKey | PAWZYKGFNFUBBN-OKZBNKHCSA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |