C17H21NO4 — CID 13496573
dimethyl (1R,2R,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-dicarboxylate (PubChem CID 13496573) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is dimethyl (1R,2R,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 13496573 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | dimethyl (1R,2R,3S,8R)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)[C@@H](c2ccccc2)N2CCC[C@H]12 |
| InChI | InChI=1S/C17H21NO4/c1-21-16(19)13-12-9-6-10-18(12)15(14(13)17(20)22-2)11-7-4-3-5-8-11/h3-5,7-8,12-15H,6,9-10H2,1-2H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | LITPSPQLJQEJAJ-LXTVHRRPSA-N |
| XLogP | 1.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |