C17H19NO7 — CID 15314816
dimethyl (3R,4R,5S)-1-(2-methoxy-2-oxoethyl)-2-oxo-5-phenylpyrrolidine-3,4-dicarboxylate (PubChem CID 15314816) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is dimethyl (3R,4R,5S)-1-(2-methoxy-2-oxoethyl)-2-oxo-5-phenylpyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl (3R,4R,5S)-1-(2-methoxy-2-oxoethyl)-2-oxo-5-phenylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15314816 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | dimethyl (3R,4R,5S)-1-(2-methoxy-2-oxoethyl)-2-oxo-5-phenylpyrrolidine-3,4-dicarboxylate |
| SMILES | COC(=O)CN1C(=O)[C@H](C(=O)OC)[C@@H](C(=O)OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19NO7/c1-23-11(19)9-18-14(10-7-5-4-6-8-10)12(16(21)24-2)13(15(18)20)17(22)25-3/h4-8,12-14H,9H2,1-3H3/t12-,13-,14-/m1/s1 |
| InChIKey | JYNNSPZNPDIYTL-MGPQQGTHSA-N |
| XLogP | 0.32 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|