C23H31NO5 — CID 139246943
(4S)-4-benzyl-3-[(2R,3S)-2-octyl-5-oxooxolane-3-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 139246943) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2R,3S)-2-octyl-5-oxooxolane-3-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2R,3S)-2-octyl-5-oxooxolane-3-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139246943 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (4S)-4-benzyl-3-[(2R,3S)-2-octyl-5-oxooxolane-3-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCC[C@H]1OC(=O)C[C@@H]1C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO5/c1-2-3-4-5-6-10-13-20-19(15-21(25)29-20)22(26)24-18(16-28-23(24)27)14-17-11-8-7-9-12-17/h7-9,11-12,18-20H,2-6,10,13-16H2,1H3/t18-,19-,20+/m0/s1 |
| InChIKey | CJQIXOTVPHAYCP-SLFFLAALSA-N |
| XLogP | 4.26 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|