C23H26BrNO3S — CID 11488375
(1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide (PubChem CID 11488375) has the molecular formula C23H26BrNO3S and a molecular weight of 476.44 g/mol. Its IUPAC name is (1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide.
| Compound Name | (1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide |
|---|---|
| PubChem CID | 11488375 |
| Molecular Formula | C23H26BrNO3S |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (1R,2R,8S,9S)-6-benzyl-9-phenylsulfanyl-7,12-dioxa-6-azoniatricyclo[6.5.0.02,6]tridecan-13-one bromide |
| SMILES | O=C1OCC[C@H](Sc2ccccc2)[C@H]2O[N+]3(Cc4ccccc4)CCC[C@@H]3[C@@H]12.[Br-] |
| InChI | InChI=1S/C23H26NO3S.BrH/c25-23-21-19-12-7-14-24(19,16-17-8-3-1-4-9-17)27-22(21)20(13-15-26-23)28-18-10-5-2-6-11-18;/h1-6,8-11,19-22H,7,12-16H2;1H/q+1;/p-1/t19-,20+,21-,22-,24?;/m1./s1 |
| InChIKey | VGBPZJACHNCFRA-FPVVQYMGSA-M |
| XLogP | 1.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|