C20H26NO5+ — CID 11408041
[(1R,2R,9S,10S)-7-benzyl-14-oxo-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-10-yl] acetate (PubChem CID 11408041) has the molecular formula C20H26NO5+ and a molecular weight of 360.43 g/mol. Its IUPAC name is [(1R,2R,9S,10S)-7-benzyl-14-oxo-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-10-yl] acetate.
| Compound Name | [(1R,2R,9S,10S)-7-benzyl-14-oxo-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-10-yl] acetate |
|---|---|
| PubChem CID | 11408041 |
| Molecular Formula | C20H26NO5+ |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(1R,2R,9S,10S)-7-benzyl-14-oxo-8,13-dioxa-7-azoniatricyclo[7.5.0.02,7]tetradecan-10-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCOC(=O)[C@H]2[C@@H]1O[N+]1(Cc3ccccc3)CCCC[C@H]21 |
| InChI | InChI=1S/C20H26NO5/c1-14(22)25-17-10-12-24-20(23)18-16-9-5-6-11-21(16,26-19(17)18)13-15-7-3-2-4-8-15/h2-4,7-8,16-19H,5-6,9-13H2,1H3/q+1/t16-,17+,18-,19-,21?/m1/s1 |
| InChIKey | UIUVWJUBLDXKAK-NKSMOILXSA-N |
| XLogP | 2.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|