C20H23F3NO+ — CID 162537106
[(2S)-1-benzyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol (PubChem CID 162537106) has the molecular formula C20H23F3NO+ and a molecular weight of 350.40 g/mol. Its IUPAC name is [(2S)-1-benzyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol.
| Compound Name | [(2S)-1-benzyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol |
|---|---|
| PubChem CID | 162537106 |
| Molecular Formula | C20H23F3NO+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(2S)-1-benzyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol |
| SMILES | OC[C@@H]1CCC[N+]1(Cc1ccccc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3NO/c21-20(22,23)18-10-8-17(9-11-18)14-24(12-4-7-19(24)15-25)13-16-5-2-1-3-6-16/h1-3,5-6,8-11,19,25H,4,7,12-15H2/q+1/t19-,24?/m0/s1 |
| InChIKey | MYXSLBQJCXBXRS-XGLRFROISA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|