C28H29F3NO+ — CID 11519400
diphenyl-[1-[[3-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]methanol (PubChem CID 11519400) has the molecular formula C28H29F3NO+ and a molecular weight of 452.54 g/mol. Its IUPAC name is diphenyl-[1-[[3-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]methanol.
| Compound Name | diphenyl-[1-[[3-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]methanol |
|---|---|
| PubChem CID | 11519400 |
| Molecular Formula | C28H29F3NO+ |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | diphenyl-[1-[[3-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]methanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C12CC[N+](Cc3cccc(C(F)(F)F)c3)(CC1)CC2 |
| InChI | InChI=1S/C28H29F3NO/c29-28(30,31)25-13-7-8-22(20-25)21-32-17-14-26(15-18-32,16-19-32)27(33,23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-13,20,33H,14-19,21H2/q+1 |
| InChIKey | ZLFLBYFAKOUNIX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|