C35H38NO2+ — CID 142486876
phenyl-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-(4-phenylphenyl)methanol (PubChem CID 142486876) has the molecular formula C35H38NO2+ and a molecular weight of 504.69 g/mol. Its IUPAC name is phenyl-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-(4-phenylphenyl)methanol.
| Compound Name | phenyl-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-(4-phenylphenyl)methanol |
|---|---|
| PubChem CID | 142486876 |
| Molecular Formula | C35H38NO2+ |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | phenyl-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-(4-phenylphenyl)methanol |
| SMILES | OC(c1ccccc1)(c1ccc(-c2ccccc2)cc1)C12CC[N+](CCOCc3ccccc3)(CC1)CC2 |
| InChI | InChI=1S/C35H38NO2/c37-35(32-14-8-3-9-15-32,33-18-16-31(17-19-33)30-12-6-2-7-13-30)34-20-23-36(24-21-34,25-22-34)26-27-38-28-29-10-4-1-5-11-29/h1-19,37H,20-28H2/q+1 |
| InChIKey | JCYOIHLURLKYJR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|