C30H33N2O+ — CID 42626013
2,2-diphenyl-2-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]acetonitrile (PubChem CID 42626013) has the molecular formula C30H33N2O+ and a molecular weight of 437.61 g/mol. Its IUPAC name is 2,2-diphenyl-2-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]acetonitrile.
| Compound Name | 2,2-diphenyl-2-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 42626013 |
| Molecular Formula | C30H33N2O+ |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 2,2-diphenyl-2-[1-(2-phenylmethoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl]acetonitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)C12CC[N+](CCOCc3ccccc3)(CC1)CC2 |
| InChI | InChI=1S/C30H33N2O/c31-25-30(27-12-6-2-7-13-27,28-14-8-3-9-15-28)29-16-19-32(20-17-29,21-18-29)22-23-33-24-26-10-4-1-5-11-26/h1-15H,16-24H2/q+1 |
| InChIKey | UMLMEOFRHWWPDV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|