C22H32N2O2+2 — CID 7366089
1,4-bis(2-phenylmethoxyethyl)piperazine-1,4-diium (PubChem CID 7366089) has the molecular formula C22H32N2O2+2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1,4-bis(2-phenylmethoxyethyl)piperazine-1,4-diium.
| Compound Name | 1,4-bis(2-phenylmethoxyethyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 7366089 |
| Molecular Formula | C22H32N2O2+2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1,4-bis(2-phenylmethoxyethyl)piperazine-1,4-diium |
| SMILES | c1ccc(COCC[NH+]2CC[NH+](CCOCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H30N2O2/c1-3-7-21(8-4-1)19-25-17-15-23-11-13-24(14-12-23)16-18-26-20-22-9-5-2-6-10-22/h1-10H,11-20H2/p+2 |
| InChIKey | JQQBBCXFNAHTTD-UHFFFAOYSA-P |
| XLogP | 0.20 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|