C32H37IN2O — CID 70681419
3-[8-methyl-8-(2-phenylmethoxyethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile iodide (PubChem CID 70681419) has the molecular formula C32H37IN2O and a molecular weight of 592.57 g/mol. Its IUPAC name is 3-[8-methyl-8-(2-phenylmethoxyethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile iodide.
| Compound Name | 3-[8-methyl-8-(2-phenylmethoxyethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile iodide |
|---|---|
| PubChem CID | 70681419 |
| Molecular Formula | C32H37IN2O |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | 3-[8-methyl-8-(2-phenylmethoxyethyl)-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile iodide |
| SMILES | C[N+]1(CCOCc2ccccc2)C2CCC1CC(CC(C#N)(c1ccccc1)c1ccccc1)C2.[I-] |
| InChI | InChI=1S/C32H37N2O.HI/c1-34(19-20-35-24-26-11-5-2-6-12-26)30-17-18-31(34)22-27(21-30)23-32(25-33,28-13-7-3-8-14-28)29-15-9-4-10-16-29;/h2-16,27,30-31H,17-24H2,1H3;1H/q+1;/p-1 |
| InChIKey | LLAKUMMDYFQHBD-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|