C29H37BrN2O2 — CID 160543425
3-[(4S,6S,8S)-5-[2-(2-methoxyethoxy)ethyl]-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide (PubChem CID 160543425) has the molecular formula C29H37BrN2O2 and a molecular weight of 525.53 g/mol. Its IUPAC name is 3-[(4S,6S,8S)-5-[2-(2-methoxyethoxy)ethyl]-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide.
| Compound Name | 3-[(4S,6S,8S)-5-[2-(2-methoxyethoxy)ethyl]-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide |
|---|---|
| PubChem CID | 160543425 |
| Molecular Formula | C29H37BrN2O2 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 3-[(4S,6S,8S)-5-[2-(2-methoxyethoxy)ethyl]-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile bromide |
| SMILES | COCCOCC[N+]1(C)[C@H]2CCC23C[C@@H](CC(C#N)(c2ccccc2)c2ccccc2)C[C@@H]31.[Br-] |
| InChI | InChI=1S/C29H37N2O2.BrH/c1-31(15-16-33-18-17-32-2)26-13-14-28(26)20-23(19-27(28)31)21-29(22-30,24-9-5-3-6-10-24)25-11-7-4-8-12-25;/h3-12,23,26-27H,13-21H2,1-2H3;1H/q+1;/p-1/t23-,26-,27-,28?,31?;/m0./s1 |
| InChIKey | DOABEOPBQRJCAQ-BGPJHOBSSA-M |
| XLogP | 1.94 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|