C28H31FNO+ — CID 11547780
[1-[(2-fluoro-3-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol (PubChem CID 11547780) has the molecular formula C28H31FNO+ and a molecular weight of 416.56 g/mol. Its IUPAC name is [1-[(2-fluoro-3-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol.
| Compound Name | [1-[(2-fluoro-3-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 11547780 |
| Molecular Formula | C28H31FNO+ |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [1-[(2-fluoro-3-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol |
| SMILES | Cc1cccc(C[N+]23CCC(C(O)(c4ccccc4)c4ccccc4)(CC2)CC3)c1F |
| InChI | InChI=1S/C28H31FNO/c1-22-9-8-10-23(26(22)29)21-30-18-15-27(16-19-30,17-20-30)28(31,24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-14,31H,15-21H2,1H3/q+1 |
| InChIKey | RAQYCYFDWBACEW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|