C26H34BrNO — CID 11626675
(1-hex-5-enyl-1-azoniabicyclo[2.2.2]octan-4-yl)-diphenylmethanol bromide (PubChem CID 11626675) has the molecular formula C26H34BrNO and a molecular weight of 456.47 g/mol. Its IUPAC name is (1-hex-5-enyl-1-azoniabicyclo[2.2.2]octan-4-yl)-diphenylmethanol bromide.
| Compound Name | (1-hex-5-enyl-1-azoniabicyclo[2.2.2]octan-4-yl)-diphenylmethanol bromide |
|---|---|
| PubChem CID | 11626675 |
| Molecular Formula | C26H34BrNO |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (1-hex-5-enyl-1-azoniabicyclo[2.2.2]octan-4-yl)-diphenylmethanol bromide |
| SMILES | C=CCCCC[N+]12CCC(C(O)(c3ccccc3)c3ccccc3)(CC1)CC2.[Br-] |
| InChI | InChI=1S/C26H34NO.BrH/c1-2-3-4-11-19-27-20-16-25(17-21-27,18-22-27)26(28,23-12-7-5-8-13-23)24-14-9-6-10-15-24;/h2,5-10,12-15,28H,1,3-4,11,16-22H2;1H/q+1;/p-1 |
| InChIKey | IZNZZAPGEQCNJX-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|