C24H25F3NO+ — CID 162537096
[(2S)-1-(naphthalen-1-ylmethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol (PubChem CID 162537096) has the molecular formula C24H25F3NO+ and a molecular weight of 400.46 g/mol. Its IUPAC name is [(2S)-1-(naphthalen-1-ylmethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol.
| Compound Name | [(2S)-1-(naphthalen-1-ylmethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol |
|---|---|
| PubChem CID | 162537096 |
| Molecular Formula | C24H25F3NO+ |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [(2S)-1-(naphthalen-1-ylmethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-ium-2-yl]methanol |
| SMILES | OC[C@@H]1CCC[N+]1(Cc1ccc(C(F)(F)F)cc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C24H25F3NO/c25-24(26,27)21-12-10-18(11-13-21)15-28(14-4-8-22(28)17-29)16-20-7-3-6-19-5-1-2-9-23(19)20/h1-3,5-7,9-13,22,29H,4,8,14-17H2/q+1/t22-,28?/m0/s1 |
| InChIKey | GUFUIACJKMIPSD-XYXHBKGXSA-N |
| XLogP | 5.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|