C27H30F3N2O+ — CID 101189315
(S)-[(1R,2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 101189315) has the molecular formula C27H30F3N2O+ and a molecular weight of 455.54 g/mol. Its IUPAC name is (S)-[(1R,2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (S)-[(1R,2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 101189315 |
| Molecular Formula | C27H30F3N2O+ |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (S)-[(1R,2R,4S,5R)-5-ethyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | CC[C@H]1C[N@@+]2(Cc3ccc(C(F)(F)F)cc3)CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C27H30F3N2O/c1-2-19-17-32(16-18-7-9-21(10-8-18)27(28,29)30)14-12-20(19)15-25(32)26(33)23-11-13-31-24-6-4-3-5-22(23)24/h3-11,13,19-20,25-26,33H,2,12,14-17H2,1H3/q+1/t19-,20-,25+,26-,32-/m0/s1 |
| InChIKey | IGBKDTKKTGUZJY-GKTULGETSA-N |
| XLogP | 6.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|