C22H24F6NO+ — CID 162537100
[(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(2-phenylethyl)pyrrolidin-1-ium-2-yl]methanol (PubChem CID 162537100) has the molecular formula C22H24F6NO+ and a molecular weight of 432.43 g/mol. Its IUPAC name is [(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(2-phenylethyl)pyrrolidin-1-ium-2-yl]methanol.
| Compound Name | [(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(2-phenylethyl)pyrrolidin-1-ium-2-yl]methanol |
|---|---|
| PubChem CID | 162537100 |
| Molecular Formula | C22H24F6NO+ |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(2-phenylethyl)pyrrolidin-1-ium-2-yl]methanol |
| SMILES | OC[C@@H]1CCC[N+]1(CCc1ccccc1)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24F6NO/c23-21(24,25)18-11-17(12-19(13-18)22(26,27)28)14-29(9-4-7-20(29)15-30)10-8-16-5-2-1-3-6-16/h1-3,5-6,11-13,20,30H,4,7-10,14-15H2/q+1/t20-,29?/m0/s1 |
| InChIKey | JZDJMYRYMBNBQF-OORIHMLWSA-N |
| XLogP | 5.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|