C15H17F6N2+ — CID 102126954
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-aza-1-azoniabicyclo[2.2.2]octane (PubChem CID 102126954) has the molecular formula C15H17F6N2+ and a molecular weight of 339.30 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-aza-1-azoniabicyclo[2.2.2]octane.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-aza-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 102126954 |
| Molecular Formula | C15H17F6N2+ |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-aza-1-azoniabicyclo[2.2.2]octane |
| SMILES | FC(F)(F)c1cc(C[N+]23CCN(CC2)CC3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F6N2/c16-14(17,18)12-7-11(8-13(9-12)15(19,20)21)10-23-4-1-22(2-5-23)3-6-23/h7-9H,1-6,10H2/q+1 |
| InChIKey | PFUSESGUQHEKED-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|