C19H23F6N4+ — CID 162611283
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane (PubChem CID 162611283) has the molecular formula C19H23F6N4+ and a molecular weight of 421.41 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane |
|---|---|
| PubChem CID | 162611283 |
| Molecular Formula | C19H23F6N4+ |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane |
| SMILES | FC(F)(F)c1cc(C[N+]23CCN4CCN5CCN(CC2)C3C54)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H23F6N4/c20-18(21,22)14-9-13(10-15(11-14)19(23,24)25)12-29-7-5-27-2-1-26-3-4-28(6-8-29)17(29)16(26)27/h9-11,16-17H,1-8,12H2/q+1 |
| InChIKey | ZWGAFEYBWOAOPP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|