C29H30F12N2 — CID 173316962
1-[1,3-bis[3,5-bis(trifluoromethyl)phenyl]propyl]-4-cyclohexylpiperazine (PubChem CID 173316962) has the molecular formula C29H30F12N2 and a molecular weight of 634.55 g/mol. Its IUPAC name is 1-[1,3-bis[3,5-bis(trifluoromethyl)phenyl]propyl]-4-cyclohexylpiperazine.
| Compound Name | 1-[1,3-bis[3,5-bis(trifluoromethyl)phenyl]propyl]-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 173316962 |
| Molecular Formula | C29H30F12N2 |
| Molecular Weight | 634.55 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 1-[1,3-bis[3,5-bis(trifluoromethyl)phenyl]propyl]-4-cyclohexylpiperazine |
| SMILES | FC(F)(F)c1cc(CCC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)N2CCN(C3CCCCC3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F12N2/c30-26(31,32)20-12-18(13-21(16-20)27(33,34)35)6-7-25(43-10-8-42(9-11-43)24-4-2-1-3-5-24)19-14-22(28(36,37)38)17-23(15-19)29(39,40)41/h12-17,24-25H,1-11H2 |
| InChIKey | LNSLDHNUZJIYOH-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.55 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |