C29H37F6N3O — CID 161237581
N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-cyclohexylpiperazin-1-yl)-2-phenylacetamide;molecular hydrogen (PubChem CID 161237581) has the molecular formula C29H37F6N3O and a molecular weight of 557.62 g/mol. Its IUPAC name is N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-cyclohexylpiperazin-1-yl)-2-phenylacetamide;molecular hydrogen.
| Compound Name | N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-cyclohexylpiperazin-1-yl)-2-phenylacetamide;molecular hydrogen |
|---|---|
| PubChem CID | 161237581 |
| Molecular Formula | C29H37F6N3O |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-cyclohexylpiperazin-1-yl)-2-phenylacetamide;molecular hydrogen |
| SMILES | O=C(NCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(c1ccccc1)N1CCN(C2CCCCC2)CC1.[H][H] |
| InChI | InChI=1S/C29H35F6N3O.H2/c30-28(31,32)23-18-21(19-24(20-23)29(33,34)35)8-7-13-36-27(39)26(22-9-3-1-4-10-22)38-16-14-37(15-17-38)25-11-5-2-6-12-25;/h1,3-4,9-10,18-20,25-26H,2,5-8,11-17H2,(H,36,39);1H |
| InChIKey | UZOQWYSYPHUQPA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|