C29H30F6N2O2 — CID 173316899
1-[3-[3,5-bis(trifluoromethyl)phenyl]-1-phenylpropyl]-4-(2,4-dimethoxyphenyl)piperazine (PubChem CID 173316899) has the molecular formula C29H30F6N2O2 and a molecular weight of 552.56 g/mol. Its IUPAC name is 1-[3-[3,5-bis(trifluoromethyl)phenyl]-1-phenylpropyl]-4-(2,4-dimethoxyphenyl)piperazine.
| Compound Name | 1-[3-[3,5-bis(trifluoromethyl)phenyl]-1-phenylpropyl]-4-(2,4-dimethoxyphenyl)piperazine |
|---|---|
| PubChem CID | 173316899 |
| Molecular Formula | C29H30F6N2O2 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 1-[3-[3,5-bis(trifluoromethyl)phenyl]-1-phenylpropyl]-4-(2,4-dimethoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(C(CCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C29H30F6N2O2/c1-38-24-9-11-26(27(19-24)39-2)37-14-12-36(13-15-37)25(21-6-4-3-5-7-21)10-8-20-16-22(28(30,31)32)18-23(17-20)29(33,34)35/h3-7,9,11,16-19,25H,8,10,12-15H2,1-2H3 |
| InChIKey | BHEHPOYHJJKFIZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|