C21H25F3N2O — CID 60590060
2-(4-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 60590060) has the molecular formula C21H25F3N2O and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 2-(4-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 60590060 |
| Molecular Formula | C21H25F3N2O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | COc1ccc(C(CNCc2cccc(C(F)(F)F)c2)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25F3N2O/c1-27-19-9-7-17(8-10-19)20(26-11-2-3-12-26)15-25-14-16-5-4-6-18(13-16)21(22,23)24/h4-10,13,20,25H,2-3,11-12,14-15H2,1H3 |
| InChIKey | AJKKGQOAQGGGIW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |