C19H23BrN2 — CID 75854274
N-[(3-bromophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine (PubChem CID 75854274) has the molecular formula C19H23BrN2 and a molecular weight of 359.31 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine.
| Compound Name | N-[(3-bromophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 75854274 |
| Molecular Formula | C19H23BrN2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-phenyl-2-pyrrolidin-1-ylethanamine |
| SMILES | Brc1cccc(CNCC(c2ccccc2)N2CCCC2)c1 |
| InChI | InChI=1S/C19H23BrN2/c20-18-10-6-7-16(13-18)14-21-15-19(22-11-4-5-12-22)17-8-2-1-3-9-17/h1-3,6-10,13,19,21H,4-5,11-12,14-15H2 |
| InChIKey | GTCBGYOZFVYUAL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |