C19H26N2O — CID 131938718
2-(azepan-1-yl)-N-(furan-3-ylmethyl)-2-phenylethanamine (PubChem CID 131938718) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-(furan-3-ylmethyl)-2-phenylethanamine.
| Compound Name | 2-(azepan-1-yl)-N-(furan-3-ylmethyl)-2-phenylethanamine |
|---|---|
| PubChem CID | 131938718 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-(azepan-1-yl)-N-(furan-3-ylmethyl)-2-phenylethanamine |
| SMILES | c1ccc(C(CNCc2ccoc2)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O/c1-2-7-12-21(11-6-1)19(18-8-4-3-5-9-18)15-20-14-17-10-13-22-16-17/h3-5,8-10,13,16,19-20H,1-2,6-7,11-12,14-15H2 |
| InChIKey | CSRIVLFBJSPCPR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |