C21H25F3N2O2 — CID 55464306
2-(3-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 55464306) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-(3-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 55464306 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-(3-methoxyphenyl)-2-pyrrolidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | COc1cccc(C(CNCc2ccc(OC(F)(F)F)cc2)N2CCCC2)c1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-27-19-6-4-5-17(13-19)20(26-11-2-3-12-26)15-25-14-16-7-9-18(10-8-16)28-21(22,23)24/h4-10,13,20,25H,2-3,11-12,14-15H2,1H3 |
| InChIKey | HPYCREFGEKHECL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |